| PRIMARY INFORMATION |
|---|
| ID | 1516 |
| PMID | 16386088 |
| Year | 2005 |
| Sequence | VV |
| Name | Dipeptide Monoester Ganciclovir |
| Length | 2 |
| N-Terminal Modification | Free |
| C-Terminal Modification | GCV=ganciclovir |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | None |
| Origin of Peptide | Synthetic |
| Nature of Peptide/Cargo | Dipeptide monoester ganciclovir prodrugs with the goal of improving ocular bioavailability of GCV from topical ophthalmic solutions |
| Mechanism | Synthetic |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | HPLC analysis, tissue hydrolysis, 2 way ANOVA |
| Enhancer | Phosphate (pH 6.4 and 7.4), and borate (pH 8.4 and 9.4) buffers (50 mM) were used. |
| Properties of enhancer | Not mentioned |
| Concentration | 50ul |
| Incubation time | Not mentioned |
| Tissue permeability (value with units) | 10.0 ng/min |
| Tissue Sample | cornea of the eye |
| Ex vivo/In vivo/In vitro | in vivo |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C=O |
