| ID | 1501 | |
| PMID | 9351503 | |
| Year | 1997 | |
| Sequence | DF-Me-Phe-GLM | |
| Name | Senktide | |
| Length | 6 | |
| N-Terminal Modification | Succinylation | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | Me-Phe=methylated phenyalanine | |
| Origin of Peptide | Rabbit iris sphincter muscle | |
| Nature of Peptide/Cargo | NK3 tachykinin receptor agonist. Causes direct excitation of dopamine neurons; enhances dopaminergic function. Induces locomotor activity. | |
| Mechanism | None | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Radioimmunoassay | |
| Enhancer | None | |
| Properties of enhancer | Not mentioned | |
| Concentration | 25µg | |
| Incubation time | 5 minutes | |
| Tissue permeability (value with units) | The mean maximum pupillary constriction observed with senktide (25 mg, i.v.) was 4.25+0.25 mm. | |
| Tissue Sample | Eye of rabbit | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C (=O)N[C@@H](Cc1ccccc1C)C(=O)NCC(=O)N[C@@H] (CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N | |