| ID | 1472 | |
| PMID | 3503119 | |
| Year | 1986 | |
| Sequence | YGGFM | |
| Name | Methionine enkephalin | |
| Length | 5 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Type of enkephalin | |
| Nature of Peptide/Cargo | Met-enkephalin, also known as metenkefalin is a opioid growth factor, naturally occurring as an endogenous opioid peptide that has opioid effects of a relatively short duration | |
| Mechanism | Type of enkephalin | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Radioactive determination | |
| Enhancer | 0.5 ml of ice-cold 0.3N perchloric acid | |
| Properties of enhancer | Not mentioned | |
| Concentration | 25µl of 50µM peptide | |
| Incubation time | 5 minutes | |
| Tissue permeability (value with units) | Tissue: Iris-Ciliary Body- degraded peptide=2.2pmoles/g tissue, Percent of recovered enkephalin attributable to degradation products=100% | |
| Tissue Sample | Superior limbus of both eyes of each male, albino New Zealand rabbits | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC (=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N [C@@H](CCSC)C=O | |