| ID | 1426 | |
| PMID | 2365569 | |
| Year | 1990 | |
| Sequence | HSDAVFTDNYTRLR KQMAVKKYLNSILN | |
| Name | Vasoactive intestinal peptide (VIP) | |
| Length | 28 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | VIP is a neuropeptide | |
| Nature of Peptide/Cargo | Potent cAMP-dependent stimulus of both fluid and protein secretion from the rat and rabbit main lacrimal gland | |
| Mechanism | VIP is a neuropeptide | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Tear film osmolarity | |
| Enhancer | The osmolarity of the solution was 302 mOsm/1, and the pH was 7.4. Aliquots of peptide stock solutions were stored at -80°C until used | |
| Properties of enhancer | Not mentioned | |
| Concentration | 2*10-7 M | |
| Incubation time | 0minutes, 6 minutes and 16 minutes for osmolarity measurement | |
| Tissue permeability (value with units) | Osmolarity measurements: t=0 min., VIP/Buffer=320/318mOsm/l; t=6 min., VIP/Buffer=303.5/310mOsm/l; t=16 min., VIP/Buffer=310/314mOsm/l | |
| Tissue Sample | Eyes of male and female New Zealand white rabbits with closed lacrimal gland excretory duct | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N [C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O) N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O) N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O) N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C (=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O) N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O) N[C@H](C(=O)N[C@H](C(=O)N[C@H](C=O)CC(=O)N)CC(C)C) [C@H](CC)C)CO)CC(=O)N)CC(C)C)Cc1ccc(cc1)O)CCCCN) CCCCN)C(C)C)C)CCSC)CCC(=O)N)CCCCN)CCCNC (=N)N)CC(C)C)CCCNC(=N)N)[C@H](O)C)Cc1ccc (cc1)O)CC(=O)N)CC(=O)O)[C@H](O)C)Cc1ccccc1) C(C)C)C)CC(=O)O)CO)Cc1[nH]cnc1 | |