| ID | 1407 | |
| PMID | 1689665 | |
| Year | 1989 | |
| Sequence | rPKPQQwFwLL | |
| Name | Spantide | |
| Length | 11 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | Mix | |
| Chemical Modification | None | |
| Origin of Peptide | A tachykinin antagonist | |
| Nature of Peptide/Cargo | Effectively prevents the miosis and the disruption of the blood-aqueous barrier consequent to ocular injury. | |
| Mechanism | A tachykinin antagonist | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Radioimmunoassay, HPLC | |
| Enhancer | Samples were treated with two volumes of ice-cold acetone to precipitate proteins and subsequently dried and dissolved in chromatography Solvent | |
| Properties of enhancer | Not mentioned | |
| Concentration | 300nmol in 50µl 0.9% NaCl (applied 4 times in 15 minutes) | |
| Incubation time | 180 minutes | |
| Tissue permeability (value with units) | Systemic uptake corresponds to a serum concentration peak of 1*10-7M after 15 minutes and intraoccular uptake corresponded to a plateau at 1.3-1.5µg/ml for 90-240 minutes after completion of application giving an approximate concentration of 10m6 M in the aqueous humor. | |
| Tissue Sample | Left eye of pigmented rabbits of either sex and weighing 2-3 kg | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@H](CCCNC(=[NH2])N)C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCCC[NH3])C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC (=O)N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1c[nH]c2ccccc12) C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H] (CC(C)C)C(=O)N | |