| ID | 1395 | |
| PMID | 8443036 | |
| Year | 1993 | |
| Sequence | KRPPGFSPFR | |
| Name | Kallidin | |
| Length | 10 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Bioactive kinin formed in response to injury from kininogen precursors through the action of kallikreins. | |
| Nature of Peptide/Cargo | Produces a mildly painful response when topically applied in nasal mucosa | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Pain response evaluated by a visual analogue scale | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 5-500 nmol (50 µl) | |
| Incubation time | 1-5 minutes | |
| Tissue permeability (value with units) | The maximal painful response was attained 1-2 min after drug administration and faded after 5 min | |
| Tissue Sample | Nostrils of human subjects | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N1CCC[C@H]1C(=O) N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](Cc1ccccc1) C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O | |