ID | 1394 | |
PMID | 8719791 | |
Year | 1995 | |
Sequence | RPPGFSPFR | |
Name | Bradykinin | |
Length | 9 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Kinin-kallikrein system makes bradykinin by proteolytic cleavage of its kininogen precursor, high-molecular-weight kininogen (HMWK or HK), by the enzyme kallikrein | |
Nature of Peptide/Cargo | Small endogenous peptide mediators formed de novo at sites of tissue damage where it has important actions that contribute to the acute inflammatory response. | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | None | |
Name of cargo | Not applicable | |
Assay | Evan's blue dye | |
Enhancer | None | |
Properties of enhancer | Not applicable | |
Concentration | 50 nmol | |
Incubation time | 60 minutes | |
Tissue permeability (value with units) | Instillation of bradykinin increased extravasation of Evans blue dye to 93.5±7.5 ng/ml from baseline 8.54±0.93 ng/ml | |
Tissue Sample | Nasal mucosa of guinea pigs | |
Ex vivo/In vivo/In vitro | in vivo | |
STRUCTURE |
| |
SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N1CCC [C@H]1C(=O)N1CCC[C@H]1C(=O)NCC(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N1CCC [C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N [C@@H](CCCNC(=[NH2])N)C=O |