| ID | 1394 | |
| PMID | 8719791 | |
| Year | 1995 | |
| Sequence | RPPGFSPFR | |
| Name | Bradykinin | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Kinin-kallikrein system makes bradykinin by proteolytic cleavage of its kininogen precursor, high-molecular-weight kininogen (HMWK or HK), by the enzyme kallikrein | |
| Nature of Peptide/Cargo | Small endogenous peptide mediators formed de novo at sites of tissue damage where it has important actions that contribute to the acute inflammatory response. | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Evan's blue dye | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 50 nmol | |
| Incubation time | 60 minutes | |
| Tissue permeability (value with units) | Instillation of bradykinin increased extravasation of Evans blue dye to 93.5±7.5 ng/ml from baseline 8.54±0.93 ng/ml | |
| Tissue Sample | Nasal mucosa of guinea pigs | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N1CCC [C@H]1C(=O)N1CCC[C@H]1C(=O)NCC(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N1CCC [C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N [C@@H](CCCNC(=[NH2])N)C=O | |