| ID | 1392 | |
| PMID | 12220890 | |
| Year | 2002 | |
| Sequence | lsaydpvdypysnsfakc | |
| Name | Retro-inverso HA 91-108 | |
| Length | 18 | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Carboxamidation | |
| Linear/ Cyclic | Linear | |
| Chirality | D | |
| Chemical Modification | Peptide conjugated to ovalbumin via the SH group of cysteine residue | |
| Origin of Peptide | Retro-inverso analogue of the influenza HA region 91-108 was synthesized by replacing the L-amino acid residues of the parent sequence with corresponding D-amino acid residues and by reversi | |
| Nature of Peptide/Cargo | Antigenic properties with increased resistance to proteolytic activity and consequently longer persistence in vivo | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | ELISA | |
| Enhancer | Mucosal adjuvant cholera toxin B (CTB) subunit | |
| Properties of enhancer | Not mentioned | |
| Concentration | 50 µg peptide/50 µl per mouse | |
| Incubation time | 3 weeks | |
| Tissue permeability (value with units) | Retro-inverso peptide induced high levels of serum IgG and lung IgA antibodies | |
| Tissue Sample | Nasal cavity of mouse | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | CC(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO) C(=O)N[C@H](C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O) N[C@H](CC(=O)O)C(=O)N1CCC[C@@H]1C(=O)N[C@H](C(C)C)C (=O)N[C@H](CC(=O)O)C(=O)N[C@H](Cc1ccc(O)cc1)C (=O)N1CCC[C@H]1C(=O)N[C@H](Cc1ccc(O)cc1) C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N [C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H] (C)C(=O)N[C@H](CCCC[NH3])C(=O)N [C@@H](CS)C=O | |