| ID | 1376 | |
| PMID | 21297299 | |
| Year | 2011 | |
| Sequence | GRKKRRQRRRCG | |
| Name | Tat analog | |
| Length | 12 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Analogue of Tat | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Sense- 5' AUC CGC GCG AUA GUA CGU ATT 3' Antisense- 5' 6-FAM UAC GUA CUA UCG CGC GGA UTT 3' | |
| Name of cargo | FAM-labeled siRNA | |
| Assay | Confocal laser microscopy | |
| Enhancer | Skin was shaved | |
| Properties of enhancer | Hairless skin eases transdermal delivery | |
| Concentration | 5 µg siRNA+ 400 µg AT1002 + 32µg Tat | |
| Incubation time | 10 hours | |
| Tissue permeability (value with units) | In Tat+AT1002 applied to 20 times tape-stripped skin, the FAMsiRNA was observed stronger than in the other conditions. | |
| Tissue Sample | Tape stripped skin of female ICR mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC[NH3])C (=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C (=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CS)C(=O)NCC=O | |