Details of TopicalPdb ID 1374
| ID | 1374 | |
| PMID | 21297299 | |
| Year | 2011 | |
| Sequence | FCIGRLCG | |
| Name | AT 1002 analog | |
| Length | 8 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Analogue of AT 1002 | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Sense- 5' GGU GCA GAA AGA AGA CAU UTT 3' Antisense- 5' AAU GUC UUC UUU CUG CAC CTT 3' | |
| Name of cargo | siRNA for GL3 | |
| Assay | Confocal laser microscopy | |
| Enhancer | Skin was shaved | |
| Properties of enhancer | Hairless skin eases transdermal delivery | |
| Concentration | 5 µg siRNA+ 400 µg peptide | |
| Incubation time | 10 hours | |
| Tissue permeability (value with units) | Fluorescent signals of FAMsiRNA in the AT1002 applied skin were observed faintly at the stratum corneum in 10 times tape-stripped skin. In 20 times tape-stripped skin FAMsiRNA was observed widely and strikingly at the stratum corneum, hair follicle, epidermal and dermal layers. | |
| Tissue Sample | Tape stripped skin of female ICR mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CS)C(=O)NCC=O | |