| ID | 1357 | |
| PMID | 1373740 | |
| Year | 1992 | |
| Sequence | AGYKPDEGKRGDACE GDSGGPFV | |
| Name | TRAP-508 | |
| Length | 23 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Human thrombin derivative | |
| Nature of Peptide/Cargo | Thromboplastin activation product of prothrombin with high clotting and esterase activity. | |
| Mechanism | They bind thrombin receptors and activate mitogenic signals. | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Histological examination and numerical scoring of cellular and tissue parameters of wound healing and determining incisional breaking strength. | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 500 pmol/cm | |
| Incubation time | 7 days | |
| Tissue permeability (value with units) | 41% increase in breaking strength, P< 0.001, at 500 pmol/cm, histology demonstrated a more advanced state of healing, ratio test/saline control of incisional breaking strength is 1.37±0.39 | |
| Tissue Sample | A single 6-cm vertical incision was made on the dorsal midline or a parallel pair of 6-cm incisions were cut 1.5 cm to either side of the midline of acclimatized adult male Harlan Sprague-Dawley rats. The wound was closed with three simple interrupted sutures placed 1.5cm apart and later received a single peptide dose. | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](C)C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCC[NH3])C (=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)NCC(=O) N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)O)C(=O) NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)NCC(=O)NCC(=O)N1CCC[C@H]1C(=O) N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C=O | |