| PRIMARY INFORMATION |
|---|
| ID | 1330 |
| PMID | 2293206 |
| Year | 1990 |
| Sequence | YaGFL |
| Name | YGGFL analogue |
| Length | 5 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Linear/ Cyclic | Linear |
| Chirality | Mix |
| Chemical Modification | None |
| Origin of Peptide | Analogue of enkephalin |
| Nature of Peptide/Cargo | Leu-enkephalin is an endogenous opioid peptide neurotransmitter that is found naturally in the brains of many animals, including humans. |
| Mechanism | Not mentioned |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | HPLC |
| Enhancer | 10 mM n-decylmethyl sulfoxide (NDMS) at 37°C at pH 5 |
| Properties of enhancer | n-decylmethyl sulfoxide, a non ionic surfactant, increased the permeabilities of several compounds upto 0.1 cm/hr |
| Concentration | 200µg/ml |
| Incubation time | 25 hours |
| Tissue permeability (value with units) | 18.5% YaGFL of the parent peptide |
| Tissue Sample | Full-thickness hairless mouse skin was excised from the fresh carcasses |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C)C(=O)NCC(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N |