Details of TopicalPdb ID 1326
ID | 1326 | |
PMID | 2293206 | |
Year | 1990 | |
Sequence | YGGFL | |
Name | Leu-enkephalin | |
Length | 5 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Type of enkephalin | |
Nature of Peptide/Cargo | Leu-enkephalin is an endogenous opioid peptide neurotransmitter that is found naturally in the brains of many animals, including humans. | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | None | |
Name of cargo | Not applicable | |
Assay | HPLC | |
Enhancer | 10 mM n-decylmethyl sulfoxide (NDMS) at 37°C at pH 5 | |
Properties of enhancer | n-decylmethyl sulfoxide, a non ionic surfactant, increased the permeabilities of several compounds upto 0.1 cm/hr | |
Concentration | 200µg/ml | |
Incubation time | 26 hours | |
Tissue permeability (value with units) | 0.03% GGFL of the parent peptide | |
Tissue Sample | Full-thickness hairless mouse skin was excised from the fresh carcasses | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C=O |