Details of TopicalPdb ID 1325
| ID | 1325 | |
| PMID | 2293206 | |
| Year | 1990 | |
| Sequence | YGGFL | |
| Name | Leu-enkephalin | |
| Length | 5 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Type of enkephalin | |
| Nature of Peptide/Cargo | Leu-enkephalin is an endogenous opioid peptide neurotransmitter that is found naturally in the brains of many animals, including humans. | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | HPLC | |
| Enhancer | 10 mM n-decylmethyl sulfoxide (NDMS) at 37°C at pH 5 | |
| Properties of enhancer | n-decylmethyl sulfoxide, a non ionic surfactant, increased the permeabilities of several compounds upto 0.1 cm/hr | |
| Concentration | 200µg/ml | |
| Incubation time | 26 hours | |
| Tissue permeability (value with units) | 0.01% GFL of the parent peptide | |
| Tissue Sample | Full-thickness hairless mouse skin was excised from the fresh carcasses | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C=O | |