| ID | 1319 | |
| PMID | 2533571 | |
| Year | 1989 | |
| Sequence | TSEKSQTPLVTL | |
| Name | des-enkephalin-ƴ-endorphin(DEƴE) | |
| Length | 12 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | A highly potent neuropeptide which has been implicated in schizophrenic psychoses | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Radioactive assay | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | Peptide concentration in the donor: 0.9*104M | |
| Incubation time | The acceptor consisting of PBS (pH 7.4) was pumped through at a flow rate of 5 ml/h and collected at hourly intervals in a fraction collector. | |
| Tissue permeability (value with units) | Permeability coefficient:1.2±0.4*105 cm/hour, flux of radiolabelled material: 1.1±0.4*1012 mol/hour/cm2 | |
| Tissue Sample | Human stratum corneum | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H]([C@@H](C)O)C (=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C) C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(C)C)C=O | |