| ID | 1310 | |
| PMID | 3573985 | |
| Year | 1987 | |
| Sequence | SYS-Nle-EHfRWGKPV | |
| Name | (Nle4, D-Phe7)-a-MSH | |
| Length | 13 | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | Mix | |
| Chemical Modification | Nle=Norleucine | |
| Origin of Peptide | Derived from α-MSH | |
| Nature of Peptide/Cargo | The analogue is superpotent, being 10- 1000 times more active than the native hormone | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Electron microscopic examination | |
| Enhancer | None | |
| Properties of enhancer | Not mentioned | |
| Concentration | Melanotropins were disolved in physiological saline and mixed with polyethylene glycol vehicle (26% PEG 400 and 74% PEG 3350, by weight) and then applied(0.25 ml) for one or more days to the shaved area at the time of new hair eruption (anagen). | |
| Incubation time | 3 days | |
| Tissue permeability (value with units) | Minimal effective dose=10-12M. It is transdermally delivered systemically to hair follicles throughout the body to induce follicular melanogenesis. Microscopic examination revealed eumelanin within hair bulbs by 24 hours after topical application of the analogue. | |
| Tissue Sample | Posterior dorsum of mice (C57BL/6JA y) | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | CC(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO) C(=O)N[C@@H](CCCC)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@H](Cc1nc[nH]c1)C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCC[NH3]) C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)N | |