| ID | 1309 | |
| PMID | 3573985 | |
| Year | 1987 | |
| Sequence | SYSMEHFRWGKPV | |
| Name | α-Melanocyte stimulating hormone (MSH) | |
| Length | 13 | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | α-MSH | |
| Nature of Peptide/Cargo | Controls pigmentary changes in many vertebrates and melanin synthesis within epidermal melanocytes is responsible for melanin pigmentation of the skin, hair, and feathers in man, birds and other mammals. | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Electron microscopic examination | |
| Enhancer | None | |
| Properties of enhancer | Not mentioned | |
| Concentration | Melanotropins were disolved in physiological saline and mixed with polyethylene glycol vehicle (26% PEG 400 and 74% PEG 3350, by weight) and then applied(0.25 ml) for one or more days to the shaved area at the time of new hair eruption (anagen). | |
| Incubation time | 3 days | |
| Tissue permeability (value with units) | Minimal effective dose=10-8to10-9M. It stimulated eumelanogenesis in all hair emerging from the areas previously plucked. | |
| Tissue Sample | Posterior dorsum of mice (C57BL/6JA y) | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | CC(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO) C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1nc[nH]c1)C(=O)N [C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](Cc1c[nH] c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCC[NH3])C(=O)N1CCC[C@H] 1C(=O)N[C@@H](C(C)C)C(=O)N | |