| ID | 1305 | |
| PMID | 3624899 | |
| Year | 1987 | |
| Sequence | SYSMEHFRWGKPV | |
| Name | Alpha-MSH (melanocyte-stimulating hormone) | |
| Length | 13 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Proteolytic cleavage product from ACTH which in turn is the cleavage product of POMC | |
| Nature of Peptide/Cargo | Stimulates melanogenesis | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Electron microscopy and Light microscopy | |
| Enhancer | PEG ointment base vehicle was used | |
| Properties of enhancer | Not mentioned | |
| Concentration | PEG ointment base(26% PEG 400 and 74% PEG 3350 ) was liquified on heating.The melanotropins were dissolved in this vehicle and 0.5 ml aliquots, the amount to be applied daily to each animal, were divided before the vehicle resolidified. | |
| Incubation time | 7 days | |
| Tissue permeability (value with units) | Concentrations (10-7 M-10-15 M) induced the emergent hairs to become brown at the sites of application. | |
| Tissue Sample | dorsal trunk of mice (C57BL/6JA y) | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C(=O)N [C@@H](CCSC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1nc[nH]c1)C(=O)N[C@@H](Cc1ccccc1)C (=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C (=O)NCC(=O)N[C@@H](CCCC[NH3])C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C=O | |