| ID | 1303 | |
| PMID | 3684299 | |
| Year | 1987 | |
| Sequence | Nle-EHfRWGK | |
| Name | [Nle4, D-Phe7]-alpha-MSH4-11 | |
| Length | 8 | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | Mix | |
| Chemical Modification | Nle=Norleucine | |
| Origin of Peptide | Derived from α-MSH | |
| Nature of Peptide/Cargo | Not mentioned | |
| Mechanism | It stimulates pheomelanin-to-eumelanin shift in the follicular melanocytes | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Light and electron microscopy | |
| Enhancer | Hairs were plucked as a pretreatment control | |
| Properties of enhancer | Not mentioned | |
| Concentration | 0.5 ml aliquots of melanotropins in poly-ethelene glycol ointment base (26% PEG '400 and 74% PEG 3350 | |
| Incubation time | Once in 24 hours for 7 days. | |
| Tissue permeability (value with units) | 10-8 to 10-14 concentrations turned yellow hair brown | |
| Tissue Sample | Melanotropin dose was applied on the shaved skin of C57BL/6AY mice which stimulated the yellow hair to turn yellow which was observed at other untouched areas proving systemic effect | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | CC(=O)N[C@@H](CCCC)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@H](Cc1nc[nH]c1) C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCC[NH3])C(=O)N | |