| ID | 1297 | |
| PMID | 7646536 | |
| Year | 1995 | |
| Sequence | HDMNKVLDL | |
| Name | Nonapeptide P2 or AF-2 | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Corresponds to the 246-254 sequence of lipocortin I | |
| Nature of Peptide/Cargo | Showed an anti-inflammatory effect in carrageenan-induced rat paw oedema, they inhibit pancreatic and Naja naja PLA2 in vitro and acute inflammatory processes induced by carrageenan or phorbol esters when administered locally or parenterally. | |
| Mechanism | The anti-inflammatory effects of AF-2 in the TPA model suggest that this nonapeptide could affect arachidonic acid mobilization and/or arachidonic acid metabolism by 5-lipoxygenase. | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | MPO and NAG assays | |
| Enhancer | AF-2 is dissolved in Tris-HCl 10mM pH 8.0 buffer. | |
| Properties of enhancer | Not mentioned | |
| Concentration | 20 µl/ear 5 min before AA(2 mg/ear)(100µg/ear)application | |
| Incubation time | 30 minutes | |
| Tissue permeability (value with units) | MPO levels(mU/ear)=Untreated(0.03)/Treated(1.68 ± 0.21), PGE2 levels(ng/ear)=Untreated(0)/Treated(80.1 ± 3.2), LTB4 levels(ng/ear)=Untreated(0)/Treated(18.1 ± 2.2) | |
| Tissue Sample | Ear(auditory pinna) of male Swiss Webster mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1nc[nH]c1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC (=O)N)C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C) C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C=O | |