| ID | 1292 | |
| PMID | 8080985 | |
| Year | 1994 | |
| Sequence | GrGDIPASSKGGGGS rLLLLLLr | |
| Name | RGD peptide matrix | |
| Length | 23 | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | Mix | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Acts as a temporary topical synthetic extracellular matrix that presents attachment sites for cells and substitutes for the damaged natural matrix and provides support for cell ingrowth into the ulcer site | |
| Mechanism | Cells attach themselves to the RGD sequences of the matrix via specific cell surface integrin receptors | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | At each visit, the ulcer was cleansed, debrided as needed, traced on acetate film for size determination, and photographed. Ulcer area was determined by computerized planimetry. Regression analysis was also done. | |
| Enhancer | This synthetic matrix consists of an RGD-containing peptide complexed with sodium hyalurohyaluronate in a sterile, nonpreserved viscous gel. | |
| Properties of enhancer | Not mentioned | |
| Concentration | Not mentioned | |
| Incubation time | >12 months | |
| Tissue permeability (value with units) | Mean percent ulcer closure at study endpoint in ulcers of varying baseline durations ~ 56% (20 patients) | |
| Tissue Sample | Patients were eligible for inclusion in the study if they presented with isolated full-thickness lower leg or ankle ulcers that did not involve bone or tendon and had persisted at least for one month. The peptide matrix is topically applied to the ulcers which were situated at the ankle | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | CC(=O)NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C (=O)N[C@@H]([C@@H](C)CC)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C (=O)N[C@@H](CO)C(=O)N[C@@H](CCCC[NH3])C(=O)NCC(=O)NCC(=O)NCC (=O)NCC(=O)N[C@H](CO)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CC(C)C)C (=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O) N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N | |