| ID | 1264 | |
| PMID | 8443036 | |
| Year | 1999 | |
| Sequence | KRPPGFSPFR | |
| Name | Kallidin | |
| Length | 10 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Potent inflammatory mediators produced during acute and chronic inflammation.They are released at high nanomolar concentrations into the tear-film of ocular allergic patients. | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Painful sensation assessed in a visual analogue scale(VAS) | |
| Enhancer | The experiment was conducted after capsaicin desensitization | |
| Properties of enhancer | Not applicable | |
| Concentration | 50µl of 500 nmol Kallidin was diluted in 0.9% saline | |
| Incubation time | At various time intervals(30 seconds and each minute for 10 minutes) | |
| Tissue permeability (value with units) | Pain response obtained in nostrils after capsaicin pretreatment((50 nmol in 50 µl, everyday for 5-7 days): ~20(VAS value), the intensity of the sensation experienced with a single dose of capsaicin was considered the maximum value (i.e. 100) on the analogue scale, and all successive responses were scored in relation to this value. | |
| Tissue Sample | Solution was applied by a micropipette into the nostril of thirty-four healthy volunteers of either sex | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N1CCC[C@H]1C(=O) N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=[NH2])N)CO | |