| ID | 1259 | |
| PMID | 8443036 | |
| Year | 1993 | |
| Sequence | KRPPGFSPFR | |
| Name | Kallidin | |
| Length | 10 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Potent inflammatory mediators produced during acute and chronic inflammation.They are released at high nanomolar concentrations into the tear-film of ocular allergic patients. | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Painful sensation assessed in a visual analogue scale(VAS) | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 50µl of 50 nmol Kallidin was diluted in 0.9% saline | |
| Incubation time | At various time intervals(30 seconds and each minute for 10 minutes) | |
| Tissue permeability (value with units) | Algesic response: ~15(VAS value), the intensity of the sensation experienced with a single dose of capsaicin was considered the maximum value (i.e. 100) on the analogue scale, and all successive responses were scored in relation to this value. Maximal painful response was attained 1-2 minutes after drug administration and faded after 5 minutes. | |
| Tissue Sample | Solution was applied by a micropipette into the nostril of thirty-four healthy volunteers of either sex | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N1CCC[C@H]1C(=O) N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=[NH2])N)CO | |