Details of TopicalPdb ID 1251
| ID | 1251 | |
| PMID | 8844762 | |
| Year | 1996 | |
| Sequence | TPRL | |
| Name | Carboranyl pseudotetrapeptide analogue of the insect pyrokinin/PBAN neuropeptide family | |
| Length | 4 | |
| N-Terminal Modification | Cbe or 2-o-carboranylethanoic acid | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Potent pheromonotropic/myotropic activity | |
| Mechanism | The amphiphylic carboranyl analogue elicits pheromone production following topical application as it contains all the structural information necessary to fully activate pyrokinin receptors. | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Cockroach Myotropic Bioassay and Pheromonotropic Assay (Topical) | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 25 pmol dissolved in 1µl of water | |
| Incubation time | 60 minutes | |
| Tissue permeability (value with units) | ~ 23 ng/female, ED50=25pmol, Maximal response=60pmol | |
| Tissue Sample | After the scales were removed, 1µl of peptide solution was applied to the surface of the cuticle and smoothed evenly over the prepared surface | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H]([C@@H](C)O)C(=O)N1CCC[C@H]1C(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CC(C)C)C(=O)N | |