| PRIMARY INFORMATION |
|---|
| ID | 1251 |
| PMID | 8844762 |
| Year | 1996 |
| Sequence | TPRL |
| Name | Carboranyl pseudotetrapeptide analogue of the insect pyrokinin/PBAN neuropeptide family |
| Length | 4 |
| N-Terminal Modification | Cbe or 2-o-carboranylethanoic acid |
| C-Terminal Modification | Amidation |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | None |
| Origin of Peptide | Synthetic |
| Nature of Peptide/Cargo | Potent pheromonotropic/myotropic activity |
| Mechanism | The amphiphylic carboranyl analogue elicits pheromone production following topical application as it contains all the structural information necessary to fully activate pyrokinin receptors. |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | Cockroach Myotropic Bioassay and Pheromonotropic Assay (Topical) |
| Enhancer | None |
| Properties of enhancer | Not applicable |
| Concentration | 25 pmol dissolved in 1µl of water |
| Incubation time | 60 minutes |
| Tissue permeability (value with units) | ~ 23 ng/female, ED50=25pmol, Maximal response=60pmol |
| Tissue Sample | After the scales were removed, 1µl of peptide solution was applied to the surface of the cuticle and smoothed evenly over the prepared surface |
| Ex vivo/In vivo/In vitro | in vivo |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H]([C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)
N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CC(C)C)C(=O)N |
