| ID | 1197 | |
| PMID | 15121311 | |
| Year | 2003 | |
| Sequence | SIINFEKL | |
| Name | OVA8 | |
| Length | 8 | |
| N-Terminal Modification | Biotin | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Ovalbumin protein | |
| Nature of Peptide/Cargo | OVA8 peptides can be used to detect a strong CD8+ cytolytic T cell response | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Histochemical staining | |
| Enhancer | Tape-stripped skin | |
| Properties of enhancer | Not mentioned | |
| Concentration | 1mM ANTP-OVA8 | |
| Incubation time | 30, 60, 90 min | |
| Tissue permeability (value with units) | Distributed uniformly on the skin surface without obvious penetration into deeper layers of the epidermis or the dermis. | |
| Tissue Sample | Tape-stripped ears of mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H] (CC(=O)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CC(C)C)C=O | |