| ID | 1192 | |
| PMID | 15734548 | |
| Year | 2005 | |
| Sequence | CGSGVRGDFGSLAPR VARQL | |
| Name | Peptide 141–159 from the VP1 protein of serotype A12 | |
| Length | 20 | |
| N-Terminal Modification | Conjugated to BSA | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic peptide representing residues 141–159 from the GH loop of VP1 protein of foot-and-mouth disease virus | |
| Nature of Peptide/Cargo | Elicits virus neutralising antibodies in mice after transcutaneous immunisation | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Neutralisation assay | |
| Enhancer | Peptide conjugated to BSA together with Cholera toxin | |
| Properties of enhancer | Elicited anti-peptide antibody responses with strong virus neutralising activity | |
| Concentration | 30 µl of 100 µg 141–159 peptide conjugated to BSA together with 100 µg Cholera Toxin | |
| Incubation time | Booster applications with the same dose and formulation were given on days 21, 42, and 63. | |
| Tissue permeability (value with units) | Neutralisation indices of anti-peptide antibody responses=2.1 after second booster | |
| Tissue Sample | Abdominal skin of BALB/c mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CS)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](C(C)C)C (=O)N[C@@H](CCCNC(=[NH2])N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1) C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O) N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](C(C)C)C(=O) N[C@@H](C)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C=O | |