| ID | 1155 | |
| PMID | 15906170 | |
| Year | 2005 | |
| Sequence | YGRKKRRQRRR | |
| Name | TAT | |
| Length | 11 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Protein transduction domain (Synthetic) | |
| Nature of Peptide/Cargo | HIV transcription factor TAT which is a protein transduction domain | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Fluorimetry analysis using Gemini SpectraMax plate reader | |
| Enhancer | None | |
| Properties of enhancer | None | |
| Concentration | FITC-labeled peptide is dissolved in phosphate-buffered saline (PBS; 10 mM, pH 7.2) to make peptide concentration 100µM | |
| Incubation time | 4 Hours | |
| Tissue permeability (value with units) | Transdermal delivery(nmol)- -̴0.06 | |
| Tissue Sample | Freshly excised porcine ear skin's stratum corneum (facing the donor compartment) was mounted in a Franz diffusion cell | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=[NH2]) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O | |