| ID | 1152 | |
| PMID | 15906170 | |
| Year | 2005 | |
| Sequence | YARAAARQARA | |
| Name | YARA | |
| Length | 11 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Molecularly modified TAT | |
| Nature of Peptide/Cargo | Molecular modification of TAT has led to the discovery of a new, optimized PTD, YARA which can penetrate intact strips of porcine coronary artery and human saphenous vein smooth muscle. | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Phosphopeptide analogue of the heat shock protein (HSP) 20 | |
| Name of cargo | P20 | |
| Assay | Fluorimetry analysis using Gemini SpectraMax plate reader | |
| Enhancer | None | |
| Properties of enhancer | None | |
| Concentration | FITC-labeled peptide is dissolved in phosphate-buffered saline (PBS; 10 mM, pH 7.2) to make peptide concentration 100µM | |
| Incubation time | 4 Hours | |
| Tissue permeability (value with units) | Rate of skin penetration(nmol/cm2/h)- -̴0.12 | |
| Tissue Sample | Freshly excised porcine ear skin's stratum corneum (facing the donor compartment) was mounted in a Franz diffusion cell | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=[NH2])N)C (=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N [C@@H](CCC(=O)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](C)C=O | |