Details of TopicalPdb ID 1151
| ID | 1151 | |
| PMID | 16113599 | |
| Year | 2007 | |
| Sequence | SIINFEKL | |
| Name | OVA257–264 | |
| Length | 8 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | It is a class I (Kb)-restricted peptide epitope of ovalbumin (OVA), presented by the class I major histocompatibility complex (MHC) molecule, H-2Kb. | |
| Mechanism | It has been demonstrated that OVA 257-264 peptides can be used to detect a strong CD8+ cytolytic T cell response. | |
| Cargo Sequence/Structure | PBS with 15% DMSO | |
| Name of cargo | Vehicle | |
| Assay | ELISPOT assay | |
| Enhancer | 37°C for 24 hours during the assay, dose applied once and tested after 7 days | |
| Properties of enhancer | Not applicable | |
| Concentration | 300 μmol peptide(10 mg/mL stock)+35µl vehicle | |
| Incubation time | 7 days | |
| Tissue permeability (value with units) | ~ 65 spots/1*106 total cells | |
| Tissue Sample | Epidermal layer of naive C57BL mice | |
| Ex vivo/In vivo/In vitro | ex vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N [C@@H](CC(=O)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CC(C)C)C=O | |