| PRIMARY INFORMATION |
|---|
| ID | 1143 |
| PMID | 16117788 |
| Year | 2005 |
| Sequence | r–nle–nle–nle–r–nle–nle–nle–g–y |
| Name | RDP58 |
| Length | 10 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Linear/ Cyclic | Linear |
| Chirality | D |
| Chemical Modification | Nle=Norleucine |
| Origin of Peptide | Derived from sequences of human class I MHC molecule |
| Nature of Peptide/Cargo | Immunomodulator |
| Mechanism | RDP58 is the first of a novel class of anti-inflammatory therapeutics that disrupt formation of the TRAF6–MyD88–IRAK complex responsible for activating crucial signal transduction pathways |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | Histological assay using bright field microscopy |
| Enhancer | Acetone |
| Properties of enhancer | Enhances skin permeability |
| Concentration | 0.01% TPA in acetone applied to the inner and outer surface of the ear every other day for 5d, RDP58 (25 mg per mL) was applied topically to the right ear after 30 min following each TPA application |
| Incubation time | 5 days |
| Tissue permeability (value with units) | It can be clearly seen from the histological images that topical application of RDP58results in significant decrease in tthe hickness of the ear skin as compared to control (TPA applied ear skin) |
| Tissue Sample | Ear of mice |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@H](CCCNC(=[NH2])N)C(=O)N[C@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC)C (=O)N[C@@H](CCCC)C(=O)N[C@@H](CCCC)C(=O)NCC(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N |