| ID | 1142 | |
| PMID | 16314471 | |
| Year | 2005 | |
| Sequence | LNQEQVSPRKKC | |
| Name | Peptide | |
| Length | 12 | |
| N-Terminal Modification | Fluorescein | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic peptide containing the α2-plasmin inhibitor motif | |
| Nature of Peptide/Cargo | Peptide containing α 2-plasmin inhibitor fibrin-binding site to the free amines on the surface of the KGF molecule | |
| Mechanism | Cell-mediated activation of plasminogen to plasmin degraded the fibrin matrix and cleaved the peptides, releasing active KGF to the local microenvironment and enhancing epithelial cell proliferation and migration | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Keratinocyte growth factor (KGF) | |
| Assay | Inverted fluorescence microscopy | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 20 µg of Fb-P-KGF | |
| Incubation time | 2days, 7days | |
| Tissue permeability (value with units) | The gradual healing of wound coould be easily visualised in th fluoresence microscopy images. Overlaid fluorescent and bright-field images of the wound show migrating cells as they degrade the fibrin matrix | |
| Tissue Sample | Human skin equivalents were grafted to athymic mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O) N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CO) C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CS)C=O | |