ID | 1140 | |
PMID | 17493711 | |
Year | 2009 | |
Sequence | TRWYSMKKTTMKIIP FNRL | |
Name | Haptide | |
Length | 19 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Cell binding and penetrating 20-mer fibrinopeptides derivative | |
Nature of Peptide/Cargo | Improve the cell penetration and subsequent presentation of the antigen. | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | Not mentioned | |
Name of cargo | Heat labile enterotoxin (nLT) | |
Assay | Anti-LT antibodies determination by ELISA | |
Enhancer | None | |
Properties of enhancer | Not applicable | |
Concentration | 100 µg/mouse | |
Incubation time | 3 times at two-week interval | |
Tissue permeability (value with units) | Significant increase in antibody titer (anti-LT) in the serum of mice on topical application with HR-gp100H | |
Tissue Sample | Ears of BALB/c mice | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N [C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C (=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCSC)C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1CCC[C@H]1C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CC(C)C)C=O |