| ID | 1138 | |
| PMID | 18426410 | |
| Year | 2008 | |
| Sequence | SLIGR | |
| Name | SLIGR | |
| Length | 5 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Peptide of the mouse PAR-2-cleaved sequence | |
| Nature of Peptide/Cargo | Activation of the human PAR-2 receptor, increase melanin depositionin vitro and in vivo | |
| Mechanism | SLIGR sequence mimic the tethered ligand Sequence of PAR-2 receptor | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Not applicable | |
| Assay | Fontana-Mason (F&M) stain | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 251 µM | |
| Incubation time | 6 weeks | |
| Tissue permeability (value with units) | The increase in pigment deposition induced by peptide can be seen in the Fontana-Mason (F&M) stained microscopic images of Human skin section skin sections | |
| Tissue Sample | Human skin samples grafted onto SCID mice | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C (=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N | |