| ID | 1135 | |
| PMID | 18426410 | |
| Year | 2008 | |
| Sequence | SLIGR | |
| Name | SLIGR | |
| Length | 5 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Peptide of the mouse PAR-2-cleaved sequence | |
| Nature of Peptide/Cargo | Activation of the human PAR-2 receptor, increase melanin depositionin vitro and in vivo | |
| Mechanism | SLIGR sequence mimic the tethered ligand Sequence of PAR-2 receptor | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Not applicable | |
| Assay | Vybrant Phagocytosis Assay | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 50 µM | |
| Incubation time | 48 hours | |
| Tissue permeability (value with units) | Significant increase in the LIGR-induced keratinocyte phagocytosis observed using Vybrant Phagocytosis Assay | |
| Tissue Sample | HaCaT keratinocytes | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C (=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N | |