| PRIMARY INFORMATION |
|---|
| ID | 1133 |
| PMID | 18426410 |
| Year | 2008 |
| Sequence | LIGR |
| Name | LIGR |
| Length | 4 |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | None |
| Origin of Peptide | Derivative of SLIGRL, a known PAR-2 activating peptide |
| Nature of Peptide/Cargo | Activation of the human PAR-2 receptor, increase melanin depositionin vitro and in vivo |
| Mechanism | LIGR sequence mimic the tethered ligand Sequence of PAR-2 receptor |
| Cargo Sequence/Structure | Not mentioned |
Name of cargo
| Not applicable |
| Assay | Fontana-Mason (F&M) stain |
| Enhancer | None |
| Properties of enhancer | Not applicable |
| Concentration | 250 µM |
| Incubation time | Twice daily, 5 days ⁄ week, for 8 weeks |
| Tissue permeability (value with units) | The increase in pigment deposition induced by peptide can be seen in the Fontana-Mason (F&M) stained microscopic images of swine skin sections |
| Tissue Sample | Dorsum skin of pigmented yucatan microswine |
| Ex vivo/In vivo/In vitro | in vitro |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C
(=O)NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N |
