| ID | 1130 | |
| PMID | 18601987 | |
| Year | 2009 | |
| Sequence | GIGKFLHSAKKFGKA FVGEIMNS | |
| Name | Magainin | |
| Length | 23 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Skin of African clawed frogs | |
| Nature of Peptide/Cargo | Antimicrobial | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Granisetron | |
| Assay | Multi-photon excitation microscopy | |
| Enhancer | PBS (pH from 7.4 to 11) or 1 wt% granisetron hydrochloride solution in PBS (pH from 5 to 10) | |
| Properties of enhancer | Changing pH can alter the structure and properties of antimicrobial peptide | |
| Concentration | 1 mM | |
| Incubation time | 12 hours | |
| Tissue permeability (value with units) | The increase in permeation of granisetron faciliated by magnine can be seen the the microscopic images | |
| Tissue Sample | Human cadaver skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O) NCC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] (Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1=CNCN1) C(=O)N[C@@H](CO)C(=O)N[C@H](O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1) C(=O)NCC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](C)C (=O)N[C@@H](CC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H] (CCC(=O)O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H] (CCSC)C(=O)N[C@@H](CC(=O)N)C (=O)N[C@@H](CO)C=O.CC.C.C.C.C.C | |