| ID | 1128 | |
| PMID | 18601987 | |
| Year | 2009 | |
| Sequence | GIGKFLHSAKKFGKA FVGEIMNS | |
| Name | Magainin | |
| Length | 23 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Skin of African clawed frogs | |
| Nature of Peptide/Cargo | Antimicrobial | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Granisetron | |
| Assay | Franz diffusion cell | |
| Enhancer | PBS (pH from 7.4 to 11) or 1 wt% granisetron hydrochloride solution in PBS (pH from 5 to 10) | |
| Properties of enhancer | Changing pH can alter the structure and properties of antimicrobial peptide | |
| Concentration | 1 mM | |
| Incubation time | 12 hours | |
| Tissue permeability (value with units) | The results suggest that positively charged magainin facilitated transdermal transport of positively charged granisetron due to electrostatic attraction at pH 10 and results in 92–fold increase in the permeation of magnine (i.e., from and average of 2.23 μg to 205.55 μg of granisetron), but as the attraction decreased with decreasing pH, the skin permeability enhancement decreased as well | |
| Tissue Sample | Human cadaver skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O) NCC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] (Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1nc[nH]c1) C(=O)N[C@@H](CO)C(=O)N[C@H](O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] (Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H](C)C(=O)N[C@@H](CC)C(=O)N[C@@H](C(C)C)C (=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H] (C)CC)C(=O)N[C@@H](CCSC)C(=O)N[C@@H] (CC(=O)N)C(=O)N[C@@H](CO)C=O.CC.C.C.C.C.C | |