| ID | 1127 | |
| PMID | 18601987 | |
| Year | 2009 | |
| Sequence | GIGKFLHSAKKFGKA FVGEIMNS | |
| Name | Magainin | |
| Length | 23 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Skin of African clawed frogs | |
| Nature of Peptide/Cargo | Antimicrobial | |
| Mechanism | Magainins can then self-assemble into transmembrane pores that make the cell membrane leaky and can also lead to cell lysis preferentially in bacterial Cells | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Fluorescein | |
| Assay | Franz diffusion cell | |
| Enhancer | PBS (pH from 7.4 to 11) or 1 wt% granisetron hydrochloride solution in PBS (pH from 5 to 10) | |
| Properties of enhancer | Changing pH can alter the structure and properties of antimicrobial peptide | |
| Concentration | 1 mM | |
| Incubation time | 12 hours | |
| Tissue permeability (value with units) | The results suggest that positively charged magainin facilitated transdermal transport of negatively charged fluorescein due to electrostatic attraction at pH 7.4 and results in 35 fold increase in the permeation of maganine by the NLS control formulation (i.e., from an average of 0.037μg to 1.302 μg of fluorescein), but as the attraction decreased with increasing pH, the skin permeability enhancement decreased as well | |
| Tissue Sample | Human cadaver skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O) NCC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] (Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1nc[nH]c1) C(=O)N[C@@H](CO)C(=O)N[C@H](O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] (Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H](C)C(=O)N[C@@H](CC)C(=O)N[C@@H](C(C)C)C (=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H] (C)CC)C(=O)N[C@@H](CCSC)C(=O)N[C@@H] (CC(=O)N)C(=O)N[C@@H](CO)C=O.CC.C.C.C.C.C | |