| ID | 1122 | |
| PMID | 18990064 | |
| Year | 2008 | |
| Sequence | GIGKFLKKAKKFG KAFVKILKK | |
| Name | Pexiganan | |
| Length | 22 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic analogue of the peptide magainin II | |
| Nature of Peptide/Cargo | Antimicrobial, Diabetic Foot Ulcers | |
| Mechanism | It kills microbial targets through disruption of bacterial cell membrane permeability (bactericidal mechanism of action).It do so in a broad spectrum of gram-positive, gram-negative, aerobic, and anerobic bacteria, as well as fungi | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Not applicable | |
| Assay | Wound healing, infection progression, and the number of amputations required were calculated statistically | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 1.05 (% w/w) pexiganan acetate | |
| Incubation time | 23 days | |
| Tissue permeability (value with units) | Clinical improvement rates were (85%–90%), Overall microbiological eradication rates (42%–47%) | |
| Tissue Sample | Diabetic Foot Ulcers | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N [C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1ccccc1)C (=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCC[NH3])C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](C)C(=O)N [C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3]) C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1) C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] ([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C=O | |