| ID | 1112 | |
| PMID | 19733297 | |
| Year | 2014 | |
| Sequence | GRKKRRQRRRPPQ | |
| Name | Tat | |
| Length | 13 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | HIV-1 | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Tat enters cells by macropinocytosis, a specialized form of fluid-phase endocytosis that occurs in all cells | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | CLXB (celecoxib) | |
| Assay | Franz cell system | |
| Enhancer | Lyotropic liquid crystals mesophases were based on GMO, EtOH, and water at concentration ratios of 57:5:38 wt %, respectively | |
| Properties of enhancer | Not mentioned | |
| Concentration | 100 mg of the formulations containing 1 wt % of CLXB together with 2 wt % of TAT | |
| Incubation time | 24 h | |
| Tissue permeability (value with units) | Kp (permeability coefficients) 1.70 in the cubic system | |
| Tissue Sample | Porcine skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C (=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCC (=O)N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N [C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N1CCC[C@H]1C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCC(=O)N)CO | |