| ID | 1107 | |
| PMID | 20223589 | |
| Year | 2010 | |
| Sequence | ACSSSPSKHCG | |
| Name | TD-1 | |
| Length | 11 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Cyclic (C2-C10) | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | De novo synthesis | |
| Nature of Peptide/Cargo | TD1 enhances the transdermal delivery of macromolecules | |
| Mechanism | TD1 overcomes the skin barrier by a distinct mechanism that most likely involves specific interactions between TD1 and unknown skin components | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Botulinum neurotoxin type A (BoNT-A) | |
| Assay | Electrical stimulation of the saphenous nerve at 4 Hz for 1 min in skin pretreated with vehicle | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 100 µL solution containing 2.5 U BoNT-A and 100 µg TD-1 in 0.9% saline 0.9% saline | |
| Incubation time | 3 and 6 h | |
| Tissue permeability (value with units) | The maximum amount of PE (Plasma Extravasation) in the control side was 68 ± 3 PIUs compared to 46 ± 2 PIUs in BoNT-A + TD-1 pretreated skin | |
| Tissue Sample | Dorsal surface of the rat hindpaw skin | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](C)C(=O)N[C@H]1CSSC[C@H] (NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC (=O)[C@H]2N(C(=O)[C@@H](NC(=O)[C@@H](NC (=O)[C@@H](NC1=O)CO)CO)CO)CCC2)CO) CCCC[NH3])Cc1nc[nH]c1)C(=O)NCC=O | |