Details of TopicalPdb ID 1104
ID | 1104 | |
PMID | 21220538 | |
Year | 2011 | |
Sequence | KWLNALLHHGLNCAK GVLA | |
Name | HG1 | |
Length | 19 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Derived from a natural AMP (halocidin) detected in the hemocytes of a tunicate, Halocynthia aurantium | |
Nature of Peptide/Cargo | Antimicrobial | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | None | |
Name of cargo | Not applicable | |
Assay | Confocal microscopy, HPLC | |
Enhancer | None | |
Properties of enhancer | Not applicable | |
Concentration | 20µl of 5% (w/v) HG1 solution | |
Incubation time | 12 hours | |
Tissue permeability (value with units) | Significant permeability of the peptide can be seen in confocal images | |
Tissue Sample | ICR mice skin | |
Ex vivo/In vivo/In vitro | ex vivo | |
STRUCTURE |
| |
SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1c[nH] c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC (=O)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O) N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1nc[nH]c1)C(=O)N[C@@H] (CC1=CNCN1)C(=O)NCC(=O)N[C@@H](CC (C)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H] (CS)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCC[NH3]) C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H] (CC(C)C)C(=O)N[C@@H](C)C(=O)N |