ID | 1099 | |
PMID | 22009459 | |
Year | 2012 | |
Sequence | ACSSSPSKHCG | |
Name | TD-1 | |
Length | 11 | |
N-Terminal Modification | FITC linked through aminocaproic (Acp) spacer | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Cyclic (C2-C10) | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Synthetic | |
Nature of Peptide/Cargo | Transdermal Delivery enhancer | |
Mechanism | Cell junction structures were disrupted in the footpad skin | |
Cargo Sequence/Structure | None | |
Name of cargo | Not applicable | |
Assay | Fluorescence microscopy, Transmission electron microscopy | |
Enhancer | Hair free zone | |
Properties of enhancer | Not applicable | |
Concentration | 1000 µg/ml | |
Incubation time | 1 hour | |
Tissue permeability (value with units) | TD1 detected strongly from epithelial tissue to subcutaneous tissue 60 min after application | |
Tissue Sample | Footpad skin of rats | |
Ex vivo/In vivo/In vitro | in vivo | |
STRUCTURE |
| |
SMILES | N[C@@H](C)C(=O)N[C@H]1CSSC[C@H] (NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC (=O)[C@H]2N(C(=O)[C@@H](NC(=O)[C@@H](NC (=O)[C@@H](NC1=O)CO)CO)CO)CCC2)CO) CCCC[NH3])Cc1nc[nH]c1)C(=O)NCC=O |