| ID | 1098 | |
| PMID | 22009459 | |
| Year | 2012 | |
| Sequence | ACSSSPSKHCG | |
| Name | TD-1 | |
| Length | 11 | |
| N-Terminal Modification | FITC linked through aminocaproic (Acp) spacer | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Cyclic (C2-C10) | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Transdermal Delivery enhancer | |
| Mechanism | Cell junction structures were disrupted in the footpad skin | |
| Cargo Sequence/Structure | UUCUCCGAACGUGUCACGUTT | |
| Name of cargo | FAM-labeled siRNA | |
| Assay | Fluorescence microscopy, Transmission electron microscopy | |
| Enhancer | Hair free zone | |
| Properties of enhancer | Not applicable | |
| Concentration | 1000 µg/ml | |
| Incubation time | 15 minutes | |
| Tissue permeability (value with units) | FAM-labeled siRNA and TD-1 topically co-administered penetrated from the stratum corneum to subcutaneous tissue 15 min after application | |
| Tissue Sample | Footpad skin of rats | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](C)C(=O)N[C@H]1CSSC[C@H] (NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC (=O)[C@H]2N(C(=O)[C@@H](NC(=O)[C@@H](NC (=O)[C@@H](NC1=O)CO)CO)CO)CCC2)CO) CCCC[NH3])Cc1nc[nH]c1)C(=O)NCC=O | |