| ID | 1095 | |
| PMID | 22072881 | |
| Year | 2011 | |
| Sequence | RKKRRQRRR | |
| Name | Tat | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | HIV-1 | |
| Nature of Peptide/Cargo | For promoting the skin penetration of molecules | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Lipophilic nature | |
| Name of cargo | Hirsutenone (HST) | |
| Assay | In vivo therapeutic efficacy assay | |
| Enhancer | Conventional cream | |
| Properties of enhancer | Not applicable | |
| Concentration | Not mentioned | |
| Incubation time | 4 weeks | |
| Tissue permeability (value with units) | Show significantly improvement in wound and dry skin but lesser than EL/T | |
| Tissue Sample | Postaxial back skin of the mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N [C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2]) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O | |