ID | 1094 | |
PMID | 22072881 | |
Year | 2011 | |
Sequence | RKKRRQRRR | |
Name | Tat | |
Length | 9 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | HIV-1 | |
Nature of Peptide/Cargo | For promoting the skin penetration of molecules | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | Lipophilic nature | |
Name of cargo | Hirsutenone (HST) | |
Assay | In vivo therapeutic efficacy assay | |
Enhancer | Elastic liposomes (EL) | |
Properties of enhancer | Phospholipid vesicular system enhancing transdermal deliveries | |
Concentration | Not mentioned | |
Incubation time | 4 weeks | |
Tissue permeability (value with units) | Show significantly improvement in wound and dry skin | |
Tissue Sample | Postaxial back skin of the mice | |
Ex vivo/In vivo/In vitro | in vivo | |
STRUCTURE |
| |
SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N [C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2]) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O |