Details of TopicalPdb ID 1092
ID | 1092 | |
PMID | 22072881 | |
Year | 2011 | |
Sequence | RKKRRQRRR | |
Name | Tat | |
Length | 9 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | HIV-1 | |
Nature of Peptide/Cargo | For promoting the skin penetration of molecules | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | Lipophilic nature | |
Name of cargo | Hirsutenone (HST) | |
Assay | Franz diffusion cells, HPLC | |
Enhancer | Elastic liposomes (EL) | |
Properties of enhancer | Phospholipid vesicular system enhancing transdermal deliveries | |
Concentration | 5.0 mg | |
Incubation time | 24 hour | |
Tissue permeability (value with units) | Permeation parameters observed were 15.74 ± 1.31% | |
Tissue Sample | Dorsal skin of mice | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N [C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2]) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O |