| ID | 1092 | |
| PMID | 22072881 | |
| Year | 2011 | |
| Sequence | RKKRRQRRR | |
| Name | Tat | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | HIV-1 | |
| Nature of Peptide/Cargo | For promoting the skin penetration of molecules | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Lipophilic nature | |
| Name of cargo | Hirsutenone (HST) | |
| Assay | Franz diffusion cells, HPLC | |
| Enhancer | Elastic liposomes (EL) | |
| Properties of enhancer | Phospholipid vesicular system enhancing transdermal deliveries | |
| Concentration | 5.0 mg | |
| Incubation time | 24 hour | |
| Tissue permeability (value with units) | Permeation parameters observed were 15.74 ± 1.31% | |
| Tissue Sample | Dorsal skin of mice | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N [C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2]) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O | |