| ID | 1091 | |
| PMID | 22189681 | |
| Year | 2011 | |
| Sequence | RKKRRQRRR | |
| Name | Tat | |
| Length | 9 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | HIV-1 | |
| Nature of Peptide/Cargo | Tat-SOD is anti-inflammatory | |
| Mechanism | Tat-SOD slightly suppressed COX-2, IL-6 and IL-1β expression | |
| Cargo Sequence/Structure | Not available | |
| Name of cargo | SOD | |
| Assay | Histochemical analysis | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 2µg/ear of mice | |
| Incubation time | 4 days | |
| Tissue permeability (value with units) | Significant permeability of the Tat-SOD peptide can be seen in histochemical images | |
| Tissue Sample | Ear of mice | |
| Ex vivo/In vivo/In vitro | in vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N [C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2]) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C=O | |