| PRIMARY INFORMATION |
|---|
| ID | 1064 |
| PMID | 22890441 |
| Year | 2012 |
| Sequence | β-Ala-H |
| Name | N-acetyl- L -carnosine |
| Length | 2 |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Linear/ Cyclic | Linear |
| Chirality | L |
| Chemical Modification | β-Alanine |
| Origin of Peptide | Synthetic |
| Nature of Peptide/Cargo | Antioxidant |
| Mechanism | It acts as antioxidant with its hydroxyl-radical-, singlet oxygen-scavenging and lipid peroxidase activities. |
| Cargo Sequence/Structure | None |
Name of cargo
| Not applicable |
| Assay | Franz diffusion cell, HPLC |
| Enhancer | Enhancer molecule hydrodispersion gel - 1,2-pentylene glycol (HDG-PG) used in the formulation applied |
| Properties of enhancer | Amphiphilicity of PG improves solubility |
| Concentration | 20mg of formulation |
| Incubation time | 300 minutes |
| Tissue permeability (value with units) | 25% of applied dose |
| Tissue Sample | Dermis of human breast skin |
| Ex vivo/In vivo/In vitro | ex vivo |
| SECONDARY INFORMATION |
|---|
| STRUCTURE | |
| SMILES | CC(=O)NC[C@@H](C)C(=O)N[C@@H](Cc1nc[nH]c1)C=O |