ID | 1025 | |
PMID | 23311648 | |
Year | 2013 | |
Sequence | GRKKRRQRRRPPQRKC | |
Name | Tat | |
Length | 16 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | HIV-1 | |
Nature of Peptide/Cargo | Cell penetrating peptide | |
Mechanism | Tat enters cells by macropinocytosis, a specialized form of fluid-phase endocytosis that occurs in all cells | |
Cargo Sequence/Structure | Not mentioned | |
Name of cargo | Human tyrosinase plasmid (pAH7/Tyr, P) | |
Assay | Vertical Franz diffusion cell | |
Enhancer | Elastic cationic niosomes | |
Properties of enhancer | Elastic niosome can squeeze themselves and pass through a small pore in stratum corneum, which is smaller than their vesicular size | |
Concentration | 1ml solution containing 30 µg of tyrosinase plasmid,20µl of trypsin solution to hydrolyze the Tat | |
Incubation time | 6 hours | |
Tissue permeability (value with units) | Cumulative amounts 0.31 ± 0.04 µg/cm2 and fluxes 1.86 ± 0.24 µg/cm2·h | |
Tissue Sample | Abdominal skin of Sprague–Dawley rats | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC [NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCC(=O) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N1CCC[C@H]1C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC[NH3])C (=O)N[C@@H](CS)C=O |